C14H21BrN2S — CID 55015691
1-(4-bromophenyl)-1-(1,4-thiazepan-4-yl)propan-2-amine (PubChem CID 55015691) has the molecular formula C14H21BrN2S and a molecular weight of 329.31 g/mol. Its IUPAC name is 1-(4-bromophenyl)-1-(1,4-thiazepan-4-yl)propan-2-amine.
| Compound Name | 1-(4-bromophenyl)-1-(1,4-thiazepan-4-yl)propan-2-amine |
|---|---|
| PubChem CID | 55015691 |
| Molecular Formula | C14H21BrN2S |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 1-(4-bromophenyl)-1-(1,4-thiazepan-4-yl)propan-2-amine |
| SMILES | CC(N)C(c1ccc(Br)cc1)N1CCCSCC1 |
| InChI | InChI=1S/C14H21BrN2S/c1-11(16)14(12-3-5-13(15)6-4-12)17-7-2-9-18-10-8-17/h3-6,11,14H,2,7-10,16H2,1H3 |
| InChIKey | LOGZCHNTXIKAGH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |