C12H18N2S — CID 97100104
4-[(1S)-1-pyridin-2-ylethyl]-1,4-thiazepane (PubChem CID 97100104) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is 4-[(1S)-1-pyridin-2-ylethyl]-1,4-thiazepane.
| Compound Name | 4-[(1S)-1-pyridin-2-ylethyl]-1,4-thiazepane |
|---|---|
| PubChem CID | 97100104 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 4-[(1S)-1-pyridin-2-ylethyl]-1,4-thiazepane |
| SMILES | C[C@@H](c1ccccn1)N1CCCSCC1 |
| InChI | InChI=1S/C12H18N2S/c1-11(12-5-2-3-6-13-12)14-7-4-9-15-10-8-14/h2-3,5-6,11H,4,7-10H2,1H3/t11-/m0/s1 |
| InChIKey | RYXPKUSEMRRTMR-NSHDSACASA-N |
| XLogP | 2.58 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |