C16H25N3S — CID 100702759
1-[(1R)-1-pyridin-2-ylethyl]-4-[[(3S)-thiolan-3-yl]methyl]piperazine (PubChem CID 100702759) has the molecular formula C16H25N3S and a molecular weight of 291.46 g/mol. Its IUPAC name is 1-[(1R)-1-pyridin-2-ylethyl]-4-[[(3S)-thiolan-3-yl]methyl]piperazine.
| Compound Name | 1-[(1R)-1-pyridin-2-ylethyl]-4-[[(3S)-thiolan-3-yl]methyl]piperazine |
|---|---|
| PubChem CID | 100702759 |
| Molecular Formula | C16H25N3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 1-[(1R)-1-pyridin-2-ylethyl]-4-[[(3S)-thiolan-3-yl]methyl]piperazine |
| SMILES | C[C@H](c1ccccn1)N1CCN(C[C@@H]2CCSC2)CC1 |
| InChI | InChI=1S/C16H25N3S/c1-14(16-4-2-3-6-17-16)19-9-7-18(8-10-19)12-15-5-11-20-13-15/h2-4,6,14-15H,5,7-13H2,1H3/t14-,15+/m1/s1 |
| InChIKey | RUZBAPVPOBSOHI-CABCVRRESA-N |
| XLogP | 2.51 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |