C14H23ClN2 — CID 55019355
1-(3-chlorophenyl)-1-N-ethyl-1-N-propylpropane-1,2-diamine (PubChem CID 55019355) has the molecular formula C14H23ClN2 and a molecular weight of 254.80 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-1-N-ethyl-1-N-propylpropane-1,2-diamine.
| Compound Name | 1-(3-chlorophenyl)-1-N-ethyl-1-N-propylpropane-1,2-diamine |
|---|---|
| PubChem CID | 55019355 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-(3-chlorophenyl)-1-N-ethyl-1-N-propylpropane-1,2-diamine |
| SMILES | CCCN(CC)C(c1cccc(Cl)c1)C(C)N |
| InChI | InChI=1S/C14H23ClN2/c1-4-9-17(5-2)14(11(3)16)12-7-6-8-13(15)10-12/h6-8,10-11,14H,4-5,9,16H2,1-3H3 |
| InChIKey | ZEYKUEDGYCHHEW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |