C15H25ClN2O — CID 55019360
2-[[2-amino-1-(3-chlorophenyl)propyl]-butylamino]ethanol (PubChem CID 55019360) has the molecular formula C15H25ClN2O and a molecular weight of 284.83 g/mol. Its IUPAC name is 2-[[2-amino-1-(3-chlorophenyl)propyl]-butylamino]ethanol.
| Compound Name | 2-[[2-amino-1-(3-chlorophenyl)propyl]-butylamino]ethanol |
|---|---|
| PubChem CID | 55019360 |
| Molecular Formula | C15H25ClN2O |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-[[2-amino-1-(3-chlorophenyl)propyl]-butylamino]ethanol |
| SMILES | CCCCN(CCO)C(c1cccc(Cl)c1)C(C)N |
| InChI | InChI=1S/C15H25ClN2O/c1-3-4-8-18(9-10-19)15(12(2)17)13-6-5-7-14(16)11-13/h5-7,11-12,15,19H,3-4,8-10,17H2,1-2H3 |
| InChIKey | KQHIEJQYRZUKFL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |