About 1-(3-methylphenyl)-1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine
1-(3-methylphenyl)-1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine (PubChem CID 55020772) has the molecular formula C13H16N2S2
and a molecular weight of 264.42 g/mol. Its IUPAC name is 1-(3-methylphenyl)-1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine.
Molecular Properties
| Compound Name | 1-(3-methylphenyl)-1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine |
| PubChem CID | 55020772 |
| Molecular Formula | C13H16N2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1-(3-methylphenyl)-1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine |
| SMILES | Cc1cccc(C(Sc2nccs2)C(C)N)c1 |
| InChI | InChI=1S/C13H16N2S2/c1-9-4-3-5-11(8-9)12(10(2)14)17-13-15-6-7-16-13/h3-8,10,12H,14H2,1-2H3 |
| InChIKey | BXWZHLREMYQABX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methylphenyl)-1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylphenyl)-1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine?
The IUPAC name of 1-(3-methylphenyl)-1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine (CID 55020772) is 1-(3-methylphenyl)-1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine.
What is the SMILES notation for 1-(3-methylphenyl)-1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine?
The canonical SMILES for 1-(3-methylphenyl)-1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine is Cc1cccc(C(Sc2nccs2)C(C)N)c1.
What is the InChIKey of 1-(3-methylphenyl)-1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine?
The InChIKey is BXWZHLREMYQABX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2S2/c1-9-4-3-5-11(8-9)12(10(2)14)17-13-15-6-7-16-13/h3-8,10,12H,14H2,1-2H3.
What are the key properties of 1-(3-methylphenyl)-1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine?
1-(3-methylphenyl)-1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine has a molecular weight of 264.42 g/mol, XLogP of 3.63, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylphenyl)-1-(1,3-thiazol-2-ylsulfanyl)propan-2-amine is sourced from PubChem (CID 55020772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).