C14H15ClFNOS — CID 55020981
1-(2-chloro-4-fluorophenoxy)-1-thiophen-2-ylbutan-2-amine (PubChem CID 55020981) has the molecular formula C14H15ClFNOS and a molecular weight of 299.80 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenoxy)-1-thiophen-2-ylbutan-2-amine.
| Compound Name | 1-(2-chloro-4-fluorophenoxy)-1-thiophen-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 55020981 |
| Molecular Formula | C14H15ClFNOS |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 1-(2-chloro-4-fluorophenoxy)-1-thiophen-2-ylbutan-2-amine |
| SMILES | CCC(N)C(Oc1ccc(F)cc1Cl)c1cccs1 |
| InChI | InChI=1S/C14H15ClFNOS/c1-2-11(17)14(13-4-3-7-19-13)18-12-6-5-9(16)8-10(12)15/h3-8,11,14H,2,17H2,1H3 |
| InChIKey | ZVZQOOGECWSTFN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |