C14H14BrCl2NOS — CID 107655935
1-(4-bromo-2,5-dichlorophenoxy)-1-thiophen-2-ylbutan-2-amine (PubChem CID 107655935) has the molecular formula C14H14BrCl2NOS and a molecular weight of 395.15 g/mol. Its IUPAC name is 1-(4-bromo-2,5-dichlorophenoxy)-1-thiophen-2-ylbutan-2-amine.
| Compound Name | 1-(4-bromo-2,5-dichlorophenoxy)-1-thiophen-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 107655935 |
| Molecular Formula | C14H14BrCl2NOS |
| Molecular Weight | 395.15 g/mol |
| Exact Mass | 392.94 |
| IUPAC Name | 1-(4-bromo-2,5-dichlorophenoxy)-1-thiophen-2-ylbutan-2-amine |
| SMILES | CCC(N)C(Oc1cc(Cl)c(Br)cc1Cl)c1cccs1 |
| InChI | InChI=1S/C14H14BrCl2NOS/c1-2-11(18)14(13-4-3-5-20-13)19-12-7-9(16)8(15)6-10(12)17/h3-7,11,14H,2,18H2,1H3 |
| InChIKey | QBIASFOQDQHDKM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.15 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|