C12H10BrCl2NOS — CID 107656089
2-(4-bromo-2,5-dichlorophenoxy)-2-thiophen-2-ylethanamine (PubChem CID 107656089) has the molecular formula C12H10BrCl2NOS and a molecular weight of 367.10 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dichlorophenoxy)-2-thiophen-2-ylethanamine.
| Compound Name | 2-(4-bromo-2,5-dichlorophenoxy)-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 107656089 |
| Molecular Formula | C12H10BrCl2NOS |
| Molecular Weight | 367.10 g/mol |
| Exact Mass | 364.90 |
| IUPAC Name | 2-(4-bromo-2,5-dichlorophenoxy)-2-thiophen-2-ylethanamine |
| SMILES | NCC(Oc1cc(Cl)c(Br)cc1Cl)c1cccs1 |
| InChI | InChI=1S/C12H10BrCl2NOS/c13-7-4-9(15)10(5-8(7)14)17-11(6-16)12-2-1-3-18-12/h1-5,11H,6,16H2 |
| InChIKey | MEXQZDYNNBEMTJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.10 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|