C14H26N2OS — CID 55022203
2-[(2-amino-1-thiophen-2-ylbutyl)-butylamino]ethanol (PubChem CID 55022203) has the molecular formula C14H26N2OS and a molecular weight of 270.44 g/mol. Its IUPAC name is 2-[(2-amino-1-thiophen-2-ylbutyl)-butylamino]ethanol.
| Compound Name | 2-[(2-amino-1-thiophen-2-ylbutyl)-butylamino]ethanol |
|---|---|
| PubChem CID | 55022203 |
| Molecular Formula | C14H26N2OS |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-[(2-amino-1-thiophen-2-ylbutyl)-butylamino]ethanol |
| SMILES | CCCCN(CCO)C(c1cccs1)C(N)CC |
| InChI | InChI=1S/C14H26N2OS/c1-3-5-8-16(9-10-17)14(12(15)4-2)13-7-6-11-18-13/h6-7,11-12,14,17H,3-5,8-10,15H2,1-2H3 |
| InChIKey | SZURHYRAFKZLOE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |