C13H14ClN3OS — CID 55022675
2-[2-amino-1-(2-chlorophenyl)propyl]sulfanyl-1H-pyrimidin-6-one (PubChem CID 55022675) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is 2-[2-amino-1-(2-chlorophenyl)propyl]sulfanyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-amino-1-(2-chlorophenyl)propyl]sulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 55022675 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-[2-amino-1-(2-chlorophenyl)propyl]sulfanyl-1H-pyrimidin-6-one |
| SMILES | CC(N)C(Sc1nccc(=O)[nH]1)c1ccccc1Cl |
| InChI | InChI=1S/C13H14ClN3OS/c1-8(15)12(9-4-2-3-5-10(9)14)19-13-16-7-6-11(18)17-13/h2-8,12H,15H2,1H3,(H,16,17,18) |
| InChIKey | LFEUFOKHHCMELJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |