C8H9N3OS — CID 60915039
3-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]butanenitrile (PubChem CID 60915039) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is 3-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]butanenitrile.
| Compound Name | 3-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]butanenitrile |
|---|---|
| PubChem CID | 60915039 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 3-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]butanenitrile |
| SMILES | CC(CC#N)Sc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C8H9N3OS/c1-6(2-4-9)13-8-10-5-3-7(12)11-8/h3,5-6H,2H2,1H3,(H,10,11,12) |
| InChIKey | NUXVCNRVJRFJQH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |