C16H14FNO — CID 55025222
3-[3-[(3-fluorophenyl)methoxy]phenyl]prop-2-yn-1-amine (PubChem CID 55025222) has the molecular formula C16H14FNO and a molecular weight of 255.29 g/mol. Its IUPAC name is 3-[3-[(3-fluorophenyl)methoxy]phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[3-[(3-fluorophenyl)methoxy]phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 55025222 |
| Molecular Formula | C16H14FNO |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 3-[3-[(3-fluorophenyl)methoxy]phenyl]prop-2-yn-1-amine |
| SMILES | NCC#Cc1cccc(OCc2cccc(F)c2)c1 |
| InChI | InChI=1S/C16H14FNO/c17-15-7-1-5-14(10-15)12-19-16-8-2-4-13(11-16)6-3-9-18/h1-2,4-5,7-8,10-11H,9,12,18H2 |
| InChIKey | FEQSGHBXHKERQA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|