C17H16FNO2 — CID 79698141
[3-[[3-(3-aminoprop-1-ynyl)-5-fluorophenyl]methoxy]phenyl]methanol (PubChem CID 79698141) has the molecular formula C17H16FNO2 and a molecular weight of 285.32 g/mol. Its IUPAC name is [3-[[3-(3-aminoprop-1-ynyl)-5-fluorophenyl]methoxy]phenyl]methanol.
| Compound Name | [3-[[3-(3-aminoprop-1-ynyl)-5-fluorophenyl]methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 79698141 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | [3-[[3-(3-aminoprop-1-ynyl)-5-fluorophenyl]methoxy]phenyl]methanol |
| SMILES | NCC#Cc1cc(F)cc(COc2cccc(CO)c2)c1 |
| InChI | InChI=1S/C17H16FNO2/c18-16-8-13(4-2-6-19)7-15(9-16)12-21-17-5-1-3-14(10-17)11-20/h1,3,5,7-10,20H,6,11-12,19H2 |
| InChIKey | CLTCVVTYIWYZCG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|