C11H19N3O4S — CID 55030199
2-[(2-methyl-1-propylimidazol-4-yl)sulfonylamino]butanoic acid (PubChem CID 55030199) has the molecular formula C11H19N3O4S and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-[(2-methyl-1-propylimidazol-4-yl)sulfonylamino]butanoic acid.
| Compound Name | 2-[(2-methyl-1-propylimidazol-4-yl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 55030199 |
| Molecular Formula | C11H19N3O4S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-[(2-methyl-1-propylimidazol-4-yl)sulfonylamino]butanoic acid |
| SMILES | CCCn1cc(S(=O)(=O)NC(CC)C(=O)O)nc1C |
| InChI | InChI=1S/C11H19N3O4S/c1-4-6-14-7-10(12-8(14)3)19(17,18)13-9(5-2)11(15)16/h7,9,13H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | SQTTWZDUJDCZBS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |