C11H21N3O3S — CID 82714897
2-methyl-N-(2-methylpropoxy)-1-propylimidazole-4-sulfonamide (PubChem CID 82714897) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is 2-methyl-N-(2-methylpropoxy)-1-propylimidazole-4-sulfonamide.
| Compound Name | 2-methyl-N-(2-methylpropoxy)-1-propylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 82714897 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-methyl-N-(2-methylpropoxy)-1-propylimidazole-4-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)NOCC(C)C)nc1C |
| InChI | InChI=1S/C11H21N3O3S/c1-5-6-14-7-11(12-10(14)4)18(15,16)13-17-8-9(2)3/h7,9,13H,5-6,8H2,1-4H3 |
| InChIKey | NFUWYFVIGYEISJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|