C12H23F3N2O2 — CID 55031816
N-pentan-3-yl-2-[2-(2,2,2-trifluoroethoxy)ethylamino]propanamide (PubChem CID 55031816) has the molecular formula C12H23F3N2O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is N-pentan-3-yl-2-[2-(2,2,2-trifluoroethoxy)ethylamino]propanamide.
| Compound Name | N-pentan-3-yl-2-[2-(2,2,2-trifluoroethoxy)ethylamino]propanamide |
|---|---|
| PubChem CID | 55031816 |
| Molecular Formula | C12H23F3N2O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N-pentan-3-yl-2-[2-(2,2,2-trifluoroethoxy)ethylamino]propanamide |
| SMILES | CCC(CC)NC(=O)C(C)NCCOCC(F)(F)F |
| InChI | InChI=1S/C12H23F3N2O2/c1-4-10(5-2)17-11(18)9(3)16-6-7-19-8-12(13,14)15/h9-10,16H,4-8H2,1-3H3,(H,17,18) |
| InChIKey | NBLDVSXZAMVSCS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|