C14H22F3NO — CID 55032056
N-[2-(2,2,2-trifluoroethoxy)ethyl]adamantan-2-amine (PubChem CID 55032056) has the molecular formula C14H22F3NO and a molecular weight of 277.33 g/mol. Its IUPAC name is N-[2-(2,2,2-trifluoroethoxy)ethyl]adamantan-2-amine.
| Compound Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]adamantan-2-amine |
|---|---|
| PubChem CID | 55032056 |
| Molecular Formula | C14H22F3NO |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]adamantan-2-amine |
| SMILES | FC(F)(F)COCCNC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C14H22F3NO/c15-14(16,17)8-19-2-1-18-13-11-4-9-3-10(6-11)7-12(13)5-9/h9-13,18H,1-8H2 |
| InChIKey | XQVNASAENMMCQM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|