C16H26F3NO — CID 79997677
3,5-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]adamantan-1-amine (PubChem CID 79997677) has the molecular formula C16H26F3NO and a molecular weight of 305.38 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]adamantan-1-amine.
| Compound Name | 3,5-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]adamantan-1-amine |
|---|---|
| PubChem CID | 79997677 |
| Molecular Formula | C16H26F3NO |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 3,5-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]adamantan-1-amine |
| SMILES | CC12CC3CC(C)(C1)CC(NCCOCC(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C16H26F3NO/c1-13-5-12-6-14(2,8-13)10-15(7-12,9-13)20-3-4-21-11-16(17,18)19/h12,20H,3-11H2,1-2H3 |
| InChIKey | AJGIUKUVHXIQAT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|