C16H26F3NO — CID 63474496
1-(1-adamantyl)-N-ethyl-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 63474496) has the molecular formula C16H26F3NO and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-(1-adamantyl)-N-ethyl-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | 1-(1-adamantyl)-N-ethyl-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 63474496 |
| Molecular Formula | C16H26F3NO |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 1-(1-adamantyl)-N-ethyl-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | CCNC(COCC(F)(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H26F3NO/c1-2-20-14(9-21-10-16(17,18)19)15-6-11-3-12(7-15)5-13(4-11)8-15/h11-14,20H,2-10H2,1H3 |
| InChIKey | FJEWSSKEYIRLPQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |