About 2-amino-5-(2,3-dimethylpiperidin-1-yl)-2-methylpentanoic acid
2-amino-5-(2,3-dimethylpiperidin-1-yl)-2-methylpentanoic acid (PubChem CID 55040235) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-amino-5-(2,3-dimethylpiperidin-1-yl)-2-methylpentanoic acid.
Analyze 2-amino-5-(2,3-dimethylpiperidin-1-yl)-2-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-(2,3-dimethylpiperidin-1-yl)-2-methylpentanoic acid?
The IUPAC name of 2-amino-5-(2,3-dimethylpiperidin-1-yl)-2-methylpentanoic acid (CID 55040235) is 2-amino-5-(2,3-dimethylpiperidin-1-yl)-2-methylpentanoic acid.
What is the SMILES notation for 2-amino-5-(2,3-dimethylpiperidin-1-yl)-2-methylpentanoic acid?
The canonical SMILES for 2-amino-5-(2,3-dimethylpiperidin-1-yl)-2-methylpentanoic acid is CC1CCCN(CCCC(C)(N)C(=O)O)C1C.
What is the InChIKey of 2-amino-5-(2,3-dimethylpiperidin-1-yl)-2-methylpentanoic acid?
The InChIKey is CGFCXBCTWRBSOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2/c1-10-6-4-8-15(11(10)2)9-5-7-13(3,14)12(16)17/h10-11H,4-9,14H2,1-3H3,(H,16,17).
What are the key properties of 2-amino-5-(2,3-dimethylpiperidin-1-yl)-2-methylpentanoic acid?
2-amino-5-(2,3-dimethylpiperidin-1-yl)-2-methylpentanoic acid has a molecular weight of 242.36 g/mol, XLogP of 1.69, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(2,3-dimethylpiperidin-1-yl)-2-methylpentanoic acid is sourced from PubChem (CID 55040235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).