C13H21N3O — CID 55042463
N-methyl-N-propan-2-yl-2-(propylamino)pyridine-4-carboxamide (PubChem CID 55042463) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is N-methyl-N-propan-2-yl-2-(propylamino)pyridine-4-carboxamide.
| Compound Name | N-methyl-N-propan-2-yl-2-(propylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55042463 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | N-methyl-N-propan-2-yl-2-(propylamino)pyridine-4-carboxamide |
| SMILES | CCCNc1cc(C(=O)N(C)C(C)C)ccn1 |
| InChI | InChI=1S/C13H21N3O/c1-5-7-14-12-9-11(6-8-15-12)13(17)16(4)10(2)3/h6,8-10H,5,7H2,1-4H3,(H,14,15) |
| InChIKey | DLMCBXYIQASWKP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |