C13H21N3O2S — CID 55043650
N-(2,2-dimethylcyclopropyl)-2-(propylamino)pyridine-3-sulfonamide (PubChem CID 55043650) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is N-(2,2-dimethylcyclopropyl)-2-(propylamino)pyridine-3-sulfonamide.
| Compound Name | N-(2,2-dimethylcyclopropyl)-2-(propylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 55043650 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-(2,2-dimethylcyclopropyl)-2-(propylamino)pyridine-3-sulfonamide |
| SMILES | CCCNc1ncccc1S(=O)(=O)NC1CC1(C)C |
| InChI | InChI=1S/C13H21N3O2S/c1-4-7-14-12-10(6-5-8-15-12)19(17,18)16-11-9-13(11,2)3/h5-6,8,11,16H,4,7,9H2,1-3H3,(H,14,15) |
| InChIKey | XEYFVVCIDRFWMY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |