About N-ethyl-5,6-dimethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine
N-ethyl-5,6-dimethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 55044818) has the molecular formula C14H15N3S2
and a molecular weight of 289.43 g/mol. Its IUPAC name is N-ethyl-5,6-dimethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-ethyl-5,6-dimethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 55044818 |
| Molecular Formula | C14H15N3S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-ethyl-5,6-dimethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCNc1nc(-c2ccsc2)nc2sc(C)c(C)c12 |
| InChI | InChI=1S/C14H15N3S2/c1-4-15-13-11-8(2)9(3)19-14(11)17-12(16-13)10-5-6-18-7-10/h5-7H,4H2,1-3H3,(H,15,16,17) |
| InChIKey | OZEPTDWQZNFRJY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-5,6-dimethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5,6-dimethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-ethyl-5,6-dimethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine (CID 55044818) is N-ethyl-5,6-dimethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-ethyl-5,6-dimethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-ethyl-5,6-dimethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine is CCNc1nc(-c2ccsc2)nc2sc(C)c(C)c12.
What is the InChIKey of N-ethyl-5,6-dimethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine?
The InChIKey is OZEPTDWQZNFRJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3S2/c1-4-15-13-11-8(2)9(3)19-14(11)17-12(16-13)10-5-6-18-7-10/h5-7H,4H2,1-3H3,(H,15,16,17).
What are the key properties of N-ethyl-5,6-dimethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine?
N-ethyl-5,6-dimethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine has a molecular weight of 289.43 g/mol, XLogP of 4.47, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5,6-dimethyl-2-thiophen-3-ylthieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 55044818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).