C14H16BrN3O — CID 55045736
2-(3-bromo-4-methoxyphenyl)-N,5,6-trimethylpyrimidin-4-amine (PubChem CID 55045736) has the molecular formula C14H16BrN3O and a molecular weight of 322.21 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-N,5,6-trimethylpyrimidin-4-amine.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-N,5,6-trimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 55045736 |
| Molecular Formula | C14H16BrN3O |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-N,5,6-trimethylpyrimidin-4-amine |
| SMILES | CNc1nc(-c2ccc(OC)c(Br)c2)nc(C)c1C |
| InChI | InChI=1S/C14H16BrN3O/c1-8-9(2)17-14(18-13(8)16-3)10-5-6-12(19-4)11(15)7-10/h5-7H,1-4H3,(H,16,17,18) |
| InChIKey | IOFSZVXHUCBKAZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |