C16H21N3 — CID 55046130
5-[(N,4-dimethylanilino)methyl]-N-ethylpyridin-2-amine (PubChem CID 55046130) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 5-[(N,4-dimethylanilino)methyl]-N-ethylpyridin-2-amine.
| Compound Name | 5-[(N,4-dimethylanilino)methyl]-N-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 55046130 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 5-[(N,4-dimethylanilino)methyl]-N-ethylpyridin-2-amine |
| SMILES | CCNc1ccc(CN(C)c2ccc(C)cc2)cn1 |
| InChI | InChI=1S/C16H21N3/c1-4-17-16-10-7-14(11-18-16)12-19(3)15-8-5-13(2)6-9-15/h5-11H,4,12H2,1-3H3,(H,17,18) |
| InChIKey | YFFARZCAQZUZDR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|