C14H21N5 — CID 55145577
N-ethyl-5-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]pyridin-2-amine (PubChem CID 55145577) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is N-ethyl-5-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]pyridin-2-amine.
| Compound Name | N-ethyl-5-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 55145577 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | N-ethyl-5-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]pyridin-2-amine |
| SMILES | CCNc1ccc(CN(C)Cc2nccn2C)cn1 |
| InChI | InChI=1S/C14H21N5/c1-4-15-13-6-5-12(9-17-13)10-18(2)11-14-16-7-8-19(14)3/h5-9H,4,10-11H2,1-3H3,(H,15,17) |
| InChIKey | LJUKUSYPSIFLOF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |