C14H28N4S — CID 55046220
4-[[bis(2-methylpropyl)amino]methyl]-N-propylthiadiazol-5-amine (PubChem CID 55046220) has the molecular formula C14H28N4S and a molecular weight of 284.47 g/mol. Its IUPAC name is 4-[[bis(2-methylpropyl)amino]methyl]-N-propylthiadiazol-5-amine.
| Compound Name | 4-[[bis(2-methylpropyl)amino]methyl]-N-propylthiadiazol-5-amine |
|---|---|
| PubChem CID | 55046220 |
| Molecular Formula | C14H28N4S |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-[[bis(2-methylpropyl)amino]methyl]-N-propylthiadiazol-5-amine |
| SMILES | CCCNc1snnc1CN(CC(C)C)CC(C)C |
| InChI | InChI=1S/C14H28N4S/c1-6-7-15-14-13(16-17-19-14)10-18(8-11(2)3)9-12(4)5/h11-12,15H,6-10H2,1-5H3 |
| InChIKey | IVTKXNZLQOTDAD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |