C12H23N5S — CID 55046442
4-[(4-ethylpiperazin-1-yl)methyl]-N-propylthiadiazol-5-amine (PubChem CID 55046442) has the molecular formula C12H23N5S and a molecular weight of 269.42 g/mol. Its IUPAC name is 4-[(4-ethylpiperazin-1-yl)methyl]-N-propylthiadiazol-5-amine.
| Compound Name | 4-[(4-ethylpiperazin-1-yl)methyl]-N-propylthiadiazol-5-amine |
|---|---|
| PubChem CID | 55046442 |
| Molecular Formula | C12H23N5S |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 4-[(4-ethylpiperazin-1-yl)methyl]-N-propylthiadiazol-5-amine |
| SMILES | CCCNc1snnc1CN1CCN(CC)CC1 |
| InChI | InChI=1S/C12H23N5S/c1-3-5-13-12-11(14-15-18-12)10-17-8-6-16(4-2)7-9-17/h13H,3-10H2,1-2H3 |
| InChIKey | ZBWDUXWTUBVRHL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |