C13H20BrN3O — CID 55047297
5-bromo-N-methyl-2-(methylamino)-N-(3-methylbutyl)pyridine-3-carboxamide (PubChem CID 55047297) has the molecular formula C13H20BrN3O and a molecular weight of 314.23 g/mol. Its IUPAC name is 5-bromo-N-methyl-2-(methylamino)-N-(3-methylbutyl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-methyl-2-(methylamino)-N-(3-methylbutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55047297 |
| Molecular Formula | C13H20BrN3O |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 5-bromo-N-methyl-2-(methylamino)-N-(3-methylbutyl)pyridine-3-carboxamide |
| SMILES | CNc1ncc(Br)cc1C(=O)N(C)CCC(C)C |
| InChI | InChI=1S/C13H20BrN3O/c1-9(2)5-6-17(4)13(18)11-7-10(14)8-16-12(11)15-3/h7-9H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | UJHNZJGWAXKBQJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |