C9H13BrN4O — CID 83022924
5-bromo-N',N'-dimethyl-2-(methylamino)pyridine-3-carbohydrazide (PubChem CID 83022924) has the molecular formula C9H13BrN4O and a molecular weight of 273.13 g/mol. Its IUPAC name is 5-bromo-N',N'-dimethyl-2-(methylamino)pyridine-3-carbohydrazide.
| Compound Name | 5-bromo-N',N'-dimethyl-2-(methylamino)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 83022924 |
| Molecular Formula | C9H13BrN4O |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 5-bromo-N',N'-dimethyl-2-(methylamino)pyridine-3-carbohydrazide |
| SMILES | CNc1ncc(Br)cc1C(=O)NN(C)C |
| InChI | InChI=1S/C9H13BrN4O/c1-11-8-7(4-6(10)5-12-8)9(15)13-14(2)3/h4-5H,1-3H3,(H,11,12)(H,13,15) |
| InChIKey | KPAFBIZYIPNORK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|