C13H22N2O4 — CID 55049627
4-hydroxy-1-(3-piperidin-4-ylpropanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 55049627) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-hydroxy-1-(3-piperidin-4-ylpropanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 4-hydroxy-1-(3-piperidin-4-ylpropanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 55049627 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 4-hydroxy-1-(3-piperidin-4-ylpropanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(O)CN1C(=O)CCC1CCNCC1 |
| InChI | InChI=1S/C13H22N2O4/c16-10-7-11(13(18)19)15(8-10)12(17)2-1-9-3-5-14-6-4-9/h9-11,14,16H,1-8H2,(H,18,19) |
| InChIKey | KTGCNPXIZMHVFM-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |