C14H14BrNO3 — CID 55053760
5-[[(2-bromophenyl)methyl-methylamino]methyl]furan-3-carboxylic acid (PubChem CID 55053760) has the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. Its IUPAC name is 5-[[(2-bromophenyl)methyl-methylamino]methyl]furan-3-carboxylic acid.
| Compound Name | 5-[[(2-bromophenyl)methyl-methylamino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 55053760 |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 5-[[(2-bromophenyl)methyl-methylamino]methyl]furan-3-carboxylic acid |
| SMILES | CN(Cc1cc(C(=O)O)co1)Cc1ccccc1Br |
| InChI | InChI=1S/C14H14BrNO3/c1-16(7-10-4-2-3-5-13(10)15)8-12-6-11(9-19-12)14(17)18/h2-6,9H,7-8H2,1H3,(H,17,18) |
| InChIKey | SQOUJKXWDJKLRB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |