C11H17NO5 — CID 62269958
5-[[(2-hydroxy-3-methoxypropyl)-methylamino]methyl]furan-3-carboxylic acid (PubChem CID 62269958) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is 5-[[(2-hydroxy-3-methoxypropyl)-methylamino]methyl]furan-3-carboxylic acid.
| Compound Name | 5-[[(2-hydroxy-3-methoxypropyl)-methylamino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 62269958 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 5-[[(2-hydroxy-3-methoxypropyl)-methylamino]methyl]furan-3-carboxylic acid |
| SMILES | COCC(O)CN(C)Cc1cc(C(=O)O)co1 |
| InChI | InChI=1S/C11H17NO5/c1-12(4-9(13)7-16-2)5-10-3-8(6-17-10)11(14)15/h3,6,9,13H,4-5,7H2,1-2H3,(H,14,15) |
| InChIKey | DNNRHQXUNFZVJD-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |