C13H13F2NO — CID 55062030
N-[(5-ethylfuran-2-yl)methyl]-2,3-difluoroaniline (PubChem CID 55062030) has the molecular formula C13H13F2NO and a molecular weight of 237.25 g/mol. Its IUPAC name is N-[(5-ethylfuran-2-yl)methyl]-2,3-difluoroaniline.
| Compound Name | N-[(5-ethylfuran-2-yl)methyl]-2,3-difluoroaniline |
|---|---|
| PubChem CID | 55062030 |
| Molecular Formula | C13H13F2NO |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-[(5-ethylfuran-2-yl)methyl]-2,3-difluoroaniline |
| SMILES | CCc1ccc(CNc2cccc(F)c2F)o1 |
| InChI | InChI=1S/C13H13F2NO/c1-2-9-6-7-10(17-9)8-16-12-5-3-4-11(14)13(12)15/h3-7,16H,2,8H2,1H3 |
| InChIKey | SSNPBFGILCXNAA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |