C12H10ClN3O2 — CID 55063355
2-(7-chloro-1,3-benzodioxol-5-yl)-6-methylpyrimidin-4-amine (PubChem CID 55063355) has the molecular formula C12H10ClN3O2 and a molecular weight of 263.68 g/mol. Its IUPAC name is 2-(7-chloro-1,3-benzodioxol-5-yl)-6-methylpyrimidin-4-amine.
| Compound Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 55063355 |
| Molecular Formula | C12H10ClN3O2 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-6-methylpyrimidin-4-amine |
| SMILES | Cc1cc(N)nc(-c2cc(Cl)c3c(c2)OCO3)n1 |
| InChI | InChI=1S/C12H10ClN3O2/c1-6-2-10(14)16-12(15-6)7-3-8(13)11-9(4-7)17-5-18-11/h2-4H,5H2,1H3,(H2,14,15,16) |
| InChIKey | UVLSFYBCHVVZDO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |