About 4-chloro-2-(7-chloro-1,3-benzodioxol-5-yl)-5-iodo-6-propan-2-ylpyrimidine
4-chloro-2-(7-chloro-1,3-benzodioxol-5-yl)-5-iodo-6-propan-2-ylpyrimidine (PubChem CID 66312270) has the molecular formula C14H11Cl2IN2O2
and a molecular weight of 437.06 g/mol. Its IUPAC name is 4-chloro-2-(7-chloro-1,3-benzodioxol-5-yl)-5-iodo-6-propan-2-ylpyrimidine.
Molecular Properties
| Compound Name | 4-chloro-2-(7-chloro-1,3-benzodioxol-5-yl)-5-iodo-6-propan-2-ylpyrimidine |
| PubChem CID | 66312270 |
| Molecular Formula | C14H11Cl2IN2O2 |
| Molecular Weight | 437.06 g/mol |
| Exact Mass | 435.92 |
| IUPAC Name | 4-chloro-2-(7-chloro-1,3-benzodioxol-5-yl)-5-iodo-6-propan-2-ylpyrimidine |
| SMILES | CC(C)c1nc(-c2cc(Cl)c3c(c2)OCO3)nc(Cl)c1I |
| InChI | InChI=1S/C14H11Cl2IN2O2/c1-6(2)11-10(17)13(16)19-14(18-11)7-3-8(15)12-9(4-7)20-5-21-12/h3-4,6H,5H2,1-2H3 |
| InChIKey | CXGFNOCHTZZWLI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.06 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-(7-chloro-1,3-benzodioxol-5-yl)-5-iodo-6-propan-2-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(7-chloro-1,3-benzodioxol-5-yl)-5-iodo-6-propan-2-ylpyrimidine?
The IUPAC name of 4-chloro-2-(7-chloro-1,3-benzodioxol-5-yl)-5-iodo-6-propan-2-ylpyrimidine (CID 66312270) is 4-chloro-2-(7-chloro-1,3-benzodioxol-5-yl)-5-iodo-6-propan-2-ylpyrimidine.
What is the SMILES notation for 4-chloro-2-(7-chloro-1,3-benzodioxol-5-yl)-5-iodo-6-propan-2-ylpyrimidine?
The canonical SMILES for 4-chloro-2-(7-chloro-1,3-benzodioxol-5-yl)-5-iodo-6-propan-2-ylpyrimidine is CC(C)c1nc(-c2cc(Cl)c3c(c2)OCO3)nc(Cl)c1I.
What is the InChIKey of 4-chloro-2-(7-chloro-1,3-benzodioxol-5-yl)-5-iodo-6-propan-2-ylpyrimidine?
The InChIKey is CXGFNOCHTZZWLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl2IN2O2/c1-6(2)11-10(17)13(16)19-14(18-11)7-3-8(15)12-9(4-7)20-5-21-12/h3-4,6H,5H2,1-2H3.
What are the key properties of 4-chloro-2-(7-chloro-1,3-benzodioxol-5-yl)-5-iodo-6-propan-2-ylpyrimidine?
4-chloro-2-(7-chloro-1,3-benzodioxol-5-yl)-5-iodo-6-propan-2-ylpyrimidine has a molecular weight of 437.06 g/mol, XLogP of 4.91, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(7-chloro-1,3-benzodioxol-5-yl)-5-iodo-6-propan-2-ylpyrimidine is sourced from PubChem (CID 66312270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).