C12H13Cl2NO2 — CID 55063476
methyl 2-(3,5-dichlorophenyl)-2-(prop-2-enylamino)acetate (PubChem CID 55063476) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is methyl 2-(3,5-dichlorophenyl)-2-(prop-2-enylamino)acetate.
| Compound Name | methyl 2-(3,5-dichlorophenyl)-2-(prop-2-enylamino)acetate |
|---|---|
| PubChem CID | 55063476 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | methyl 2-(3,5-dichlorophenyl)-2-(prop-2-enylamino)acetate |
| SMILES | C=CCNC(C(=O)OC)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2NO2/c1-3-4-15-11(12(16)17-2)8-5-9(13)7-10(14)6-8/h3,5-7,11,15H,1,4H2,2H3 |
| InChIKey | DLKZLOOVIRMDMR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|