C9H16N4O2S2 — CID 55068751
2-[(1-methylimidazol-4-yl)sulfonylamino]pentanethioamide (PubChem CID 55068751) has the molecular formula C9H16N4O2S2 and a molecular weight of 276.39 g/mol. Its IUPAC name is 2-[(1-methylimidazol-4-yl)sulfonylamino]pentanethioamide.
| Compound Name | 2-[(1-methylimidazol-4-yl)sulfonylamino]pentanethioamide |
|---|---|
| PubChem CID | 55068751 |
| Molecular Formula | C9H16N4O2S2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-[(1-methylimidazol-4-yl)sulfonylamino]pentanethioamide |
| SMILES | CCCC(NS(=O)(=O)c1cn(C)cn1)C(N)=S |
| InChI | InChI=1S/C9H16N4O2S2/c1-3-4-7(9(10)16)12-17(14,15)8-5-13(2)6-11-8/h5-7,12H,3-4H2,1-2H3,(H2,10,16) |
| InChIKey | PIXGXWXEKKXNSM-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|