C9H17N3O3S — CID 79256266
N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-1-methylimidazole-4-sulfonamide (PubChem CID 79256266) has the molecular formula C9H17N3O3S and a molecular weight of 247.32 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 79256266 |
| Molecular Formula | C9H17N3O3S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-1-methylimidazole-4-sulfonamide |
| SMILES | CC(C)[C@@H](CO)NS(=O)(=O)c1cn(C)cn1 |
| InChI | InChI=1S/C9H17N3O3S/c1-7(2)8(5-13)11-16(14,15)9-4-12(3)6-10-9/h4,6-8,11,13H,5H2,1-3H3/t8-/m1/s1 |
| InChIKey | XEAPHVKJPQTZHM-MRVPVSSYSA-N |
| XLogP | -0.28 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |