C14H19NO3 — CID 55073492
N-[[5-(furan-2-ylmethoxymethyl)furan-2-yl]methyl]propan-1-amine (PubChem CID 55073492) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-[[5-(furan-2-ylmethoxymethyl)furan-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(furan-2-ylmethoxymethyl)furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 55073492 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-[[5-(furan-2-ylmethoxymethyl)furan-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(COCc2ccco2)o1 |
| InChI | InChI=1S/C14H19NO3/c1-2-7-15-9-12-5-6-14(18-12)11-16-10-13-4-3-8-17-13/h3-6,8,15H,2,7,9-11H2,1H3 |
| InChIKey | LBNRUNPBWAGRIA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 47.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|