C15H27NO4 — CID 103401729
N-[[5-[3-(2-methoxyethoxy)propoxymethyl]furan-2-yl]methyl]propan-1-amine (PubChem CID 103401729) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is N-[[5-[3-(2-methoxyethoxy)propoxymethyl]furan-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-[3-(2-methoxyethoxy)propoxymethyl]furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 103401729 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | N-[[5-[3-(2-methoxyethoxy)propoxymethyl]furan-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(COCCCOCCOC)o1 |
| InChI | InChI=1S/C15H27NO4/c1-3-7-16-12-14-5-6-15(20-14)13-19-9-4-8-18-11-10-17-2/h5-6,16H,3-4,7-13H2,1-2H3 |
| InChIKey | JLTWSWKBSOXGSL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|