C16H29NO4 — CID 103401859
N-[[5-[3-(2-methoxyethoxy)propoxymethyl]furan-2-yl]methyl]-2-methylpropan-2-amine (PubChem CID 103401859) has the molecular formula C16H29NO4 and a molecular weight of 299.41 g/mol. Its IUPAC name is N-[[5-[3-(2-methoxyethoxy)propoxymethyl]furan-2-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[5-[3-(2-methoxyethoxy)propoxymethyl]furan-2-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 103401859 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | N-[[5-[3-(2-methoxyethoxy)propoxymethyl]furan-2-yl]methyl]-2-methylpropan-2-amine |
| SMILES | COCCOCCCOCc1ccc(CNC(C)(C)C)o1 |
| InChI | InChI=1S/C16H29NO4/c1-16(2,3)17-12-14-6-7-15(21-14)13-20-9-5-8-19-11-10-18-4/h6-7,17H,5,8-13H2,1-4H3 |
| InChIKey | CZTBRFLRCGRCLJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|