C16H29NO2 — CID 62457603
N-[[5-(hexoxymethyl)furan-2-yl]methyl]-2-methylpropan-2-amine (PubChem CID 62457603) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is N-[[5-(hexoxymethyl)furan-2-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[5-(hexoxymethyl)furan-2-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 62457603 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | N-[[5-(hexoxymethyl)furan-2-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CCCCCCOCc1ccc(CNC(C)(C)C)o1 |
| InChI | InChI=1S/C16H29NO2/c1-5-6-7-8-11-18-13-15-10-9-14(19-15)12-17-16(2,3)4/h9-10,17H,5-8,11-13H2,1-4H3 |
| InChIKey | HQUMLLKXQCONKE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|