C11H21N5S — CID 55074770
N-[[1-(2-thiomorpholin-4-ylethyl)triazol-4-yl]methyl]ethanamine (PubChem CID 55074770) has the molecular formula C11H21N5S and a molecular weight of 255.39 g/mol. Its IUPAC name is N-[[1-(2-thiomorpholin-4-ylethyl)triazol-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-(2-thiomorpholin-4-ylethyl)triazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 55074770 |
| Molecular Formula | C11H21N5S |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N-[[1-(2-thiomorpholin-4-ylethyl)triazol-4-yl]methyl]ethanamine |
| SMILES | CCNCc1cn(CCN2CCSCC2)nn1 |
| InChI | InChI=1S/C11H21N5S/c1-2-12-9-11-10-16(14-13-11)4-3-15-5-7-17-8-6-15/h10,12H,2-9H2,1H3 |
| InChIKey | AEWUGGVJZLYMCH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |