C13H12Cl3NO2 — CID 55077682
[3-methyl-5-[(2,4,5-trichlorophenoxy)methyl]furan-2-yl]methanamine (PubChem CID 55077682) has the molecular formula C13H12Cl3NO2 and a molecular weight of 320.60 g/mol. Its IUPAC name is [3-methyl-5-[(2,4,5-trichlorophenoxy)methyl]furan-2-yl]methanamine.
| Compound Name | [3-methyl-5-[(2,4,5-trichlorophenoxy)methyl]furan-2-yl]methanamine |
|---|---|
| PubChem CID | 55077682 |
| Molecular Formula | C13H12Cl3NO2 |
| Molecular Weight | 320.60 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | [3-methyl-5-[(2,4,5-trichlorophenoxy)methyl]furan-2-yl]methanamine |
| SMILES | Cc1cc(COc2cc(Cl)c(Cl)cc2Cl)oc1CN |
| InChI | InChI=1S/C13H12Cl3NO2/c1-7-2-8(19-13(7)5-17)6-18-12-4-10(15)9(14)3-11(12)16/h2-4H,5-6,17H2,1H3 |
| InChIKey | MPZPPQUFZDGOIJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|