C13H26F3NO — CID 55083200
N-propan-2-yl-2-propyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine (PubChem CID 55083200) has the molecular formula C13H26F3NO and a molecular weight of 269.35 g/mol. Its IUPAC name is N-propan-2-yl-2-propyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine.
| Compound Name | N-propan-2-yl-2-propyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
|---|---|
| PubChem CID | 55083200 |
| Molecular Formula | C13H26F3NO |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | N-propan-2-yl-2-propyl-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
| SMILES | CCCC(CCCOCC(F)(F)F)CNC(C)C |
| InChI | InChI=1S/C13H26F3NO/c1-4-6-12(9-17-11(2)3)7-5-8-18-10-13(14,15)16/h11-12,17H,4-10H2,1-3H3 |
| InChIKey | HMWXRPZWQUAPCA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|