C16H34N2 — CID 55087820
N',N'-dibutyl-N-cyclopentylpropane-1,3-diamine (PubChem CID 55087820) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is N',N'-dibutyl-N-cyclopentylpropane-1,3-diamine.
| Compound Name | N',N'-dibutyl-N-cyclopentylpropane-1,3-diamine |
|---|---|
| PubChem CID | 55087820 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | N',N'-dibutyl-N-cyclopentylpropane-1,3-diamine |
| SMILES | CCCCN(CCCC)CCCNC1CCCC1 |
| InChI | InChI=1S/C16H34N2/c1-3-5-13-18(14-6-4-2)15-9-12-17-16-10-7-8-11-16/h16-17H,3-15H2,1-2H3 |
| InChIKey | PJUKTQSWVKROQJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|