About N-butylcyclohexanamine;dimethylarsanyloxy(dimethyl)arsane
N-butylcyclohexanamine;dimethylarsanyloxy(dimethyl)arsane (PubChem CID 174757062) has the molecular formula C14H33As2NO
and a molecular weight of 381.27 g/mol. Its IUPAC name is N-butylcyclohexanamine;dimethylarsanyloxy(dimethyl)arsane.
Molecular Properties
| Compound Name | N-butylcyclohexanamine;dimethylarsanyloxy(dimethyl)arsane |
| PubChem CID | 174757062 |
| Molecular Formula | C14H33As2NO |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-butylcyclohexanamine;dimethylarsanyloxy(dimethyl)arsane |
| SMILES | CCCCNC1CCCCC1.C[As](C)O[As](C)C |
| InChI | InChI=1S/C10H21N.C4H12As2O/c1-2-3-9-11-10-7-5-4-6-8-10;1-5(2)7-6(3)4/h10-11H,2-9H2,1H3;1-4H3 |
| InChIKey | AVDDQEGARSUQSC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-butylcyclohexanamine;dimethylarsanyloxy(dimethyl)arsane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylcyclohexanamine;dimethylarsanyloxy(dimethyl)arsane?
The IUPAC name of N-butylcyclohexanamine;dimethylarsanyloxy(dimethyl)arsane (CID 174757062) is N-butylcyclohexanamine;dimethylarsanyloxy(dimethyl)arsane.
What is the SMILES notation for N-butylcyclohexanamine;dimethylarsanyloxy(dimethyl)arsane?
The canonical SMILES for N-butylcyclohexanamine;dimethylarsanyloxy(dimethyl)arsane is CCCCNC1CCCCC1.C[As](C)O[As](C)C.
What is the InChIKey of N-butylcyclohexanamine;dimethylarsanyloxy(dimethyl)arsane?
The InChIKey is AVDDQEGARSUQSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N.C4H12As2O/c1-2-3-9-11-10-7-5-4-6-8-10;1-5(2)7-6(3)4/h10-11H,2-9H2,1H3;1-4H3.
What are the key properties of N-butylcyclohexanamine;dimethylarsanyloxy(dimethyl)arsane?
N-butylcyclohexanamine;dimethylarsanyloxy(dimethyl)arsane has a molecular weight of 381.27 g/mol, XLogP of 4.21, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylcyclohexanamine;dimethylarsanyloxy(dimethyl)arsane is sourced from PubChem (CID 174757062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).