About N-[2-(3,5-difluorophenyl)ethyl]cycloheptanamine
N-[2-(3,5-difluorophenyl)ethyl]cycloheptanamine (PubChem CID 55091377) has the molecular formula C15H21F2N
and a molecular weight of 253.34 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]cycloheptanamine.
Molecular Properties
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]cycloheptanamine |
| PubChem CID | 55091377 |
| Molecular Formula | C15H21F2N |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]cycloheptanamine |
| SMILES | Fc1cc(F)cc(CCNC2CCCCCC2)c1 |
| InChI | InChI=1S/C15H21F2N/c16-13-9-12(10-14(17)11-13)7-8-18-15-5-3-1-2-4-6-15/h9-11,15,18H,1-8H2 |
| InChIKey | VZJVRYSZRFDMRY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[2-(3,5-difluorophenyl)ethyl]cycloheptanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,5-difluorophenyl)ethyl]cycloheptanamine?
The IUPAC name of N-[2-(3,5-difluorophenyl)ethyl]cycloheptanamine (CID 55091377) is N-[2-(3,5-difluorophenyl)ethyl]cycloheptanamine.
What is the SMILES notation for N-[2-(3,5-difluorophenyl)ethyl]cycloheptanamine?
The canonical SMILES for N-[2-(3,5-difluorophenyl)ethyl]cycloheptanamine is Fc1cc(F)cc(CCNC2CCCCCC2)c1.
What is the InChIKey of N-[2-(3,5-difluorophenyl)ethyl]cycloheptanamine?
The InChIKey is VZJVRYSZRFDMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F2N/c16-13-9-12(10-14(17)11-13)7-8-18-15-5-3-1-2-4-6-15/h9-11,15,18H,1-8H2.
What are the key properties of N-[2-(3,5-difluorophenyl)ethyl]cycloheptanamine?
N-[2-(3,5-difluorophenyl)ethyl]cycloheptanamine has a molecular weight of 253.34 g/mol, XLogP of 3.82, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,5-difluorophenyl)ethyl]cycloheptanamine is sourced from PubChem (CID 55091377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).